About 5-methylquinazoline-2,4,6-triamine
5-methylquinazoline-2,4,6-triamine (PubChem CID 13413778) has the molecular formula C9H11N5
and a molecular weight of 189.22 g/mol. Its IUPAC name is 5-methylquinazoline-2,4,6-triamine.
Molecular Properties
| Compound Name | 5-methylquinazoline-2,4,6-triamine |
| PubChem CID | 13413778 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 5-methylquinazoline-2,4,6-triamine |
| SMILES | Cc1c(N)ccc2nc(N)nc(N)c12 |
| InChI | InChI=1S/C9H11N5/c1-4-5(10)2-3-6-7(4)8(11)14-9(12)13-6/h2-3H,10H2,1H3,(H4,11,12,13,14) |
| InChIKey | LYLCQCMWHDZXFW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-methylquinazoline-2,4,6-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylquinazoline-2,4,6-triamine?
The IUPAC name of 5-methylquinazoline-2,4,6-triamine (CID 13413778) is 5-methylquinazoline-2,4,6-triamine.
What is the SMILES notation for 5-methylquinazoline-2,4,6-triamine?
The canonical SMILES for 5-methylquinazoline-2,4,6-triamine is Cc1c(N)ccc2nc(N)nc(N)c12.
What is the InChIKey of 5-methylquinazoline-2,4,6-triamine?
The InChIKey is LYLCQCMWHDZXFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5/c1-4-5(10)2-3-6-7(4)8(11)14-9(12)13-6/h2-3H,10H2,1H3,(H4,11,12,13,14).
What are the key properties of 5-methylquinazoline-2,4,6-triamine?
5-methylquinazoline-2,4,6-triamine has a molecular weight of 189.22 g/mol, XLogP of 0.68, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylquinazoline-2,4,6-triamine is sourced from PubChem (CID 13413778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).