C8H9ClN4O6S2 — CID 13413784
2,4-diaminoquinazoline-6-sulfonyl chloride;sulfuric acid (PubChem CID 13413784) has the molecular formula C8H9ClN4O6S2 and a molecular weight of 356.77 g/mol. Its IUPAC name is 2,4-diaminoquinazoline-6-sulfonyl chloride;sulfuric acid.
| Compound Name | 2,4-diaminoquinazoline-6-sulfonyl chloride;sulfuric acid |
|---|---|
| PubChem CID | 13413784 |
| Molecular Formula | C8H9ClN4O6S2 |
| Molecular Weight | 356.77 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | 2,4-diaminoquinazoline-6-sulfonyl chloride;sulfuric acid |
| SMILES | Nc1nc(N)c2cc(S(=O)(=O)Cl)ccc2n1.O=S(=O)(O)O |
| InChI | InChI=1S/C8H7ClN4O2S.H2O4S/c9-16(14,15)4-1-2-6-5(3-4)7(10)13-8(11)12-6;1-5(2,3)4/h1-3H,(H4,10,11,12,13);(H2,1,2,3,4) |
| InChIKey | YEIZCIHTAAWELE-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 186.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.77 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|