C11H14N2 — CID 13413786
1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinoxaline (PubChem CID 13413786) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinoxaline.
| Compound Name | 1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 13413786 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinoxaline |
| SMILES | c1ccc2c(c1)NCC1CCCN21 |
| InChI | InChI=1S/C11H14N2/c1-2-6-11-10(5-1)12-8-9-4-3-7-13(9)11/h1-2,5-6,9,12H,3-4,7-8H2 |
| InChIKey | IZAIOGMVPVWOKY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |