C25H23NO8 — CID 134137872
diethyl (3R)-3-(2-hydroxy-5-methoxyphenyl)-5-oxo-3,4-dihydrochromeno[3,4-b]pyridine-1,2-dicarboxylate (PubChem CID 134137872) has the molecular formula C25H23NO8 and a molecular weight of 465.46 g/mol. Its IUPAC name is diethyl (3R)-3-(2-hydroxy-5-methoxyphenyl)-5-oxo-3,4-dihydrochromeno[3,4-b]pyridine-1,2-dicarboxylate.
| Compound Name | diethyl (3R)-3-(2-hydroxy-5-methoxyphenyl)-5-oxo-3,4-dihydrochromeno[3,4-b]pyridine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134137872 |
| Molecular Formula | C25H23NO8 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | diethyl (3R)-3-(2-hydroxy-5-methoxyphenyl)-5-oxo-3,4-dihydrochromeno[3,4-b]pyridine-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)[C@@H](c2cc(OC)ccc2O)Nc2c1c1ccccc1oc2=O |
| InChI | InChI=1S/C25H23NO8/c1-4-32-23(28)19-18-14-8-6-7-9-17(14)34-25(30)22(18)26-21(20(19)24(29)33-5-2)15-12-13(31-3)10-11-16(15)27/h6-12,21,26-27H,4-5H2,1-3H3/t21-/m1/s1 |
| InChIKey | AOFSMOCTZKRREA-OAQYLSRUSA-N |
| XLogP | 3.55 |
| TPSA | 124.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|