C23H25NO3 — CID 134137960
(1E,4Z,6E)-1,7-bis(4-hydroxyphenyl)-5-(2-methylpropylamino)hepta-1,4,6-trien-3-one (PubChem CID 134137960) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is (1E,4Z,6E)-1,7-bis(4-hydroxyphenyl)-5-(2-methylpropylamino)hepta-1,4,6-trien-3-one.
| Compound Name | (1E,4Z,6E)-1,7-bis(4-hydroxyphenyl)-5-(2-methylpropylamino)hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 134137960 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (1E,4Z,6E)-1,7-bis(4-hydroxyphenyl)-5-(2-methylpropylamino)hepta-1,4,6-trien-3-one |
| SMILES | CC(C)CNC(=C\C(=O)/C=C/c1ccc(O)cc1)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C23H25NO3/c1-17(2)16-24-20(9-3-18-4-10-21(25)11-5-18)15-23(27)14-8-19-6-12-22(26)13-7-19/h3-15,17,24-26H,16H2,1-2H3/b9-3+,14-8+,20-15- |
| InChIKey | NUPUBKPJDVTATF-VYNYELTFSA-N |
| XLogP | 4.52 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|