C33H45N3O4 — CID 134138184
ethyl (1R,4S,5R,9S,10R,13S,14S)-14-[4-[(4-acetylphenoxy)methyl]triazol-1-yl]-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 134138184) has the molecular formula C33H45N3O4 and a molecular weight of 547.74 g/mol. Its IUPAC name is ethyl (1R,4S,5R,9S,10R,13S,14S)-14-[4-[(4-acetylphenoxy)methyl]triazol-1-yl]-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | ethyl (1R,4S,5R,9S,10R,13S,14S)-14-[4-[(4-acetylphenoxy)methyl]triazol-1-yl]-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 134138184 |
| Molecular Formula | C33H45N3O4 |
| Molecular Weight | 547.74 g/mol |
| Exact Mass | 547.34 |
| IUPAC Name | ethyl (1R,4S,5R,9S,10R,13S,14S)-14-[4-[(4-acetylphenoxy)methyl]triazol-1-yl]-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3CC[C@@]4(C)C[C@]3(CC[C@@H]21)C[C@@H]4n1cc(COc2ccc(C(C)=O)cc2)nn1 |
| InChI | InChI=1S/C33H45N3O4/c1-6-39-29(38)32(5)15-7-14-31(4)26(32)13-17-33-18-28(30(3,21-33)16-12-27(31)33)36-19-24(34-35-36)20-40-25-10-8-23(9-11-25)22(2)37/h8-11,19,26-28H,6-7,12-18,20-21H2,1-5H3/t26-,27-,28-,30-,31+,32+,33-/m0/s1 |
| InChIKey | KAZKELNNSALTJC-HMFNEEIUSA-N |
| XLogP | 6.97 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.74 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |