C29H42O5S — CID 134138293
ethyl (1R,4S,5R,9S,10R,13S,14R)-5,9,13-trimethyl-14-(4-methylphenyl)sulfonyloxytetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 134138293) has the molecular formula C29H42O5S and a molecular weight of 502.72 g/mol. Its IUPAC name is ethyl (1R,4S,5R,9S,10R,13S,14R)-5,9,13-trimethyl-14-(4-methylphenyl)sulfonyloxytetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | ethyl (1R,4S,5R,9S,10R,13S,14R)-5,9,13-trimethyl-14-(4-methylphenyl)sulfonyloxytetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 134138293 |
| Molecular Formula | C29H42O5S |
| Molecular Weight | 502.72 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | ethyl (1R,4S,5R,9S,10R,13S,14R)-5,9,13-trimethyl-14-(4-methylphenyl)sulfonyloxytetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3CC[C@@]4(C)C[C@]3(CC[C@@H]21)C[C@H]4OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H42O5S/c1-6-33-25(30)28(5)15-7-14-27(4)22(28)13-17-29-18-24(26(3,19-29)16-12-23(27)29)34-35(31,32)21-10-8-20(2)9-11-21/h8-11,22-24H,6-7,12-19H2,1-5H3/t22-,23-,24+,26-,27+,28+,29-/m0/s1 |
| InChIKey | VMUVTORVQQLFSJ-MYINBUQOSA-N |
| XLogP | 6.44 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.72 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|