About 2-[[4-(4-phenoxyphenyl)triazol-1-yl]methyl]-4,5-diphenyl-1,3-oxazole
2-[[4-(4-phenoxyphenyl)triazol-1-yl]methyl]-4,5-diphenyl-1,3-oxazole (PubChem CID 134138399) has the molecular formula C30H22N4O2
and a molecular weight of 470.53 g/mol. Its IUPAC name is 2-[[4-(4-phenoxyphenyl)triazol-1-yl]methyl]-4,5-diphenyl-1,3-oxazole.
Molecular Properties
| Compound Name | 2-[[4-(4-phenoxyphenyl)triazol-1-yl]methyl]-4,5-diphenyl-1,3-oxazole |
| PubChem CID | 134138399 |
| Molecular Formula | C30H22N4O2 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 2-[[4-(4-phenoxyphenyl)triazol-1-yl]methyl]-4,5-diphenyl-1,3-oxazole |
| SMILES | c1ccc(Oc2ccc(-c3cn(Cc4nc(-c5ccccc5)c(-c5ccccc5)o4)nn3)cc2)cc1 |
| InChI | InChI=1S/C30H22N4O2/c1-4-10-23(11-5-1)29-30(24-12-6-2-7-13-24)36-28(31-29)21-34-20-27(32-33-34)22-16-18-26(19-17-22)35-25-14-8-3-9-15-25/h1-20H,21H2 |
| InChIKey | NBDBHMLOXSVPDS-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 65.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[4-(4-phenoxyphenyl)triazol-1-yl]methyl]-4,5-diphenyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(4-phenoxyphenyl)triazol-1-yl]methyl]-4,5-diphenyl-1,3-oxazole?
The IUPAC name of 2-[[4-(4-phenoxyphenyl)triazol-1-yl]methyl]-4,5-diphenyl-1,3-oxazole (CID 134138399) is 2-[[4-(4-phenoxyphenyl)triazol-1-yl]methyl]-4,5-diphenyl-1,3-oxazole.
What is the SMILES notation for 2-[[4-(4-phenoxyphenyl)triazol-1-yl]methyl]-4,5-diphenyl-1,3-oxazole?
The canonical SMILES for 2-[[4-(4-phenoxyphenyl)triazol-1-yl]methyl]-4,5-diphenyl-1,3-oxazole is c1ccc(Oc2ccc(-c3cn(Cc4nc(-c5ccccc5)c(-c5ccccc5)o4)nn3)cc2)cc1.
What is the InChIKey of 2-[[4-(4-phenoxyphenyl)triazol-1-yl]methyl]-4,5-diphenyl-1,3-oxazole?
The InChIKey is NBDBHMLOXSVPDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H22N4O2/c1-4-10-23(11-5-1)29-30(24-12-6-2-7-13-24)36-28(31-29)21-34-20-27(32-33-34)22-16-18-26(19-17-22)35-25-14-8-3-9-15-25/h1-20H,21H2.
What are the key properties of 2-[[4-(4-phenoxyphenyl)triazol-1-yl]methyl]-4,5-diphenyl-1,3-oxazole?
2-[[4-(4-phenoxyphenyl)triazol-1-yl]methyl]-4,5-diphenyl-1,3-oxazole has a molecular weight of 470.53 g/mol, XLogP of 7.11, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(4-phenoxyphenyl)triazol-1-yl]methyl]-4,5-diphenyl-1,3-oxazole is sourced from PubChem (CID 134138399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).