C31H43NO7 — CID 134138507
[(3S,5R)-7-[(1S,2S,6R,8S,8aR)-2,6-dimethyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-5-hydroxy-1-(hydroxyamino)-1-oxoheptan-3-yl] benzoate (PubChem CID 134138507) has the molecular formula C31H43NO7 and a molecular weight of 541.69 g/mol. Its IUPAC name is [(3S,5R)-7-[(1S,2S,6R,8S,8aR)-2,6-dimethyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-5-hydroxy-1-(hydroxyamino)-1-oxoheptan-3-yl] benzoate.
| Compound Name | [(3S,5R)-7-[(1S,2S,6R,8S,8aR)-2,6-dimethyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-5-hydroxy-1-(hydroxyamino)-1-oxoheptan-3-yl] benzoate |
|---|---|
| PubChem CID | 134138507 |
| Molecular Formula | C31H43NO7 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.30 |
| IUPAC Name | [(3S,5R)-7-[(1S,2S,6R,8S,8aR)-2,6-dimethyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-5-hydroxy-1-(hydroxyamino)-1-oxoheptan-3-yl] benzoate |
| SMILES | CC[C@H](C)C(=O)O[C@H]1C[C@@H](C)C=C2C=C[C@H](C)[C@H](CC[C@@H](O)C[C@@H](CC(=O)NO)OC(=O)c3ccccc3)[C@H]21 |
| InChI | InChI=1S/C31H43NO7/c1-5-20(3)30(35)39-27-16-19(2)15-23-12-11-21(4)26(29(23)27)14-13-24(33)17-25(18-28(34)32-37)38-31(36)22-9-7-6-8-10-22/h6-12,15,19-21,24-27,29,33,37H,5,13-14,16-18H2,1-4H3,(H,32,34)/t19-,20-,21-,24+,25-,26-,27-,29-/m0/s1 |
| InChIKey | ONXRLVXHFDMWQE-MSQMLLKSSA-N |
| XLogP | 5.00 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|