C25H23N3O2 — CID 134138526
(E)-N-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-3-(3-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-enamide (PubChem CID 134138526) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is (E)-N-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-3-(3-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-enamide.
| Compound Name | (E)-N-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-3-(3-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 134138526 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | (E)-N-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-3-(3-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-enamide |
| SMILES | C[C@@H](NC(=O)/C=C/c1cnc2[nH]cc(-c3ccccc3)c2c1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C25H23N3O2/c1-17(24(30)20-10-6-3-7-11-20)28-23(29)13-12-18-14-21-22(16-27-25(21)26-15-18)19-8-4-2-5-9-19/h2-17,24,30H,1H3,(H,26,27)(H,28,29)/b13-12+/t17-,24-/m1/s1 |
| InChIKey | LHOQGWQNUGSEBJ-ZQINLGPMSA-N |
| XLogP | 4.48 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|