C26H41NO — CID 134138720
(3R,8R,9S,10S,13S,14S,17E)-17-ethylidene-10,13-dimethyl-3-piperidin-1-yl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-16-one (PubChem CID 134138720) has the molecular formula C26H41NO and a molecular weight of 383.62 g/mol. Its IUPAC name is (3R,8R,9S,10S,13S,14S,17E)-17-ethylidene-10,13-dimethyl-3-piperidin-1-yl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-16-one.
| Compound Name | (3R,8R,9S,10S,13S,14S,17E)-17-ethylidene-10,13-dimethyl-3-piperidin-1-yl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-16-one |
|---|---|
| PubChem CID | 134138720 |
| Molecular Formula | C26H41NO |
| Molecular Weight | 383.62 g/mol |
| Exact Mass | 383.32 |
| IUPAC Name | (3R,8R,9S,10S,13S,14S,17E)-17-ethylidene-10,13-dimethyl-3-piperidin-1-yl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-16-one |
| SMILES | C/C=C1/C(=O)C[C@H]2[C@@H]3CCC4C[C@H](N5CCCCC5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H41NO/c1-4-21-24(28)17-23-20-9-8-18-16-19(27-14-6-5-7-15-27)10-12-25(18,2)22(20)11-13-26(21,23)3/h4,18-20,22-23H,5-17H2,1-3H3/b21-4-/t18?,19-,20-,22+,23+,25+,26-/m1/s1 |
| InChIKey | CUOMHCIEOJDYRM-DOODVHHYSA-N |
| XLogP | 6.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.62 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|