C22H17BrN2 — CID 134138793
2-benzyl-13-methyl-8-aza-2-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaene bromide (PubChem CID 134138793) has the molecular formula C22H17BrN2 and a molecular weight of 389.30 g/mol. Its IUPAC name is 2-benzyl-13-methyl-8-aza-2-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaene bromide.
| Compound Name | 2-benzyl-13-methyl-8-aza-2-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaene bromide |
|---|---|
| PubChem CID | 134138793 |
| Molecular Formula | C22H17BrN2 |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 2-benzyl-13-methyl-8-aza-2-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaene bromide |
| SMILES | Cc1ccc2c(c1)-c1c3c-2nccc3cc[n+]1Cc1ccccc1.[Br-] |
| InChI | InChI=1S/C22H17N2.BrH/c1-15-7-8-18-19(13-15)22-20-17(9-11-23-21(18)20)10-12-24(22)14-16-5-3-2-4-6-16;/h2-13H,14H2,1H3;1H/q+1;/p-1 |
| InChIKey | WKGNYQJKJIABIV-UHFFFAOYSA-M |
| XLogP | 1.53 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|