C28H40O3 — CID 134138871
(1S,2R,5R,6S,9R,10R,13R,14R,15R)-6-(hydroxymethyl)-2,6,9-trimethyl-15-prop-1-en-2-ylpentacyclo[11.7.0.02,10.05,9.014,18]icosa-7,17-diene-1-carboxylic acid (PubChem CID 134138871) has the molecular formula C28H40O3 and a molecular weight of 424.63 g/mol. Its IUPAC name is (1S,2R,5R,6S,9R,10R,13R,14R,15R)-6-(hydroxymethyl)-2,6,9-trimethyl-15-prop-1-en-2-ylpentacyclo[11.7.0.02,10.05,9.014,18]icosa-7,17-diene-1-carboxylic acid.
| Compound Name | (1S,2R,5R,6S,9R,10R,13R,14R,15R)-6-(hydroxymethyl)-2,6,9-trimethyl-15-prop-1-en-2-ylpentacyclo[11.7.0.02,10.05,9.014,18]icosa-7,17-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 134138871 |
| Molecular Formula | C28H40O3 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | (1S,2R,5R,6S,9R,10R,13R,14R,15R)-6-(hydroxymethyl)-2,6,9-trimethyl-15-prop-1-en-2-ylpentacyclo[11.7.0.02,10.05,9.014,18]icosa-7,17-diene-1-carboxylic acid |
| SMILES | C=C(C)[C@@H]1CC=C2CC[C@]3(C(=O)O)[C@H](CC[C@@H]4[C@@]5(C)C=C[C@](C)(CO)[C@@H]5CC[C@]43C)[C@H]21 |
| InChI | InChI=1S/C28H40O3/c1-17(2)19-7-6-18-10-13-28(24(30)31)20(23(18)19)8-9-22-26(4)15-14-25(3,16-29)21(26)11-12-27(22,28)5/h6,14-15,19-23,29H,1,7-13,16H2,2-5H3,(H,30,31)/t19-,20+,21-,22+,23+,25+,26-,27+,28+/m0/s1 |
| InChIKey | WYNFYRLSVJBZKS-PDLLVWRBSA-N |
| XLogP | 6.01 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|