C16H16N6S — CID 134138940
N-[(E)-1-pyrazin-2-ylethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 134138940) has the molecular formula C16H16N6S and a molecular weight of 324.41 g/mol. Its IUPAC name is N-[(E)-1-pyrazin-2-ylethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(E)-1-pyrazin-2-ylethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 134138940 |
| Molecular Formula | C16H16N6S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | N-[(E)-1-pyrazin-2-ylethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | C/C(=N\Nc1ncnc2sc3c(c12)CCCC3)c1cnccn1 |
| InChI | InChI=1S/C16H16N6S/c1-10(12-8-17-6-7-18-12)21-22-15-14-11-4-2-3-5-13(11)23-16(14)20-9-19-15/h6-9H,2-5H2,1H3,(H,19,20,22)/b21-10+ |
| InChIKey | TUYXBDJVSHGIJT-UFFVCSGVSA-N |
| XLogP | 3.20 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|