About (Z)-2-(3,5-dimethoxyphenyl)-3-(4-propoxyphenyl)prop-2-enenitrile
(Z)-2-(3,5-dimethoxyphenyl)-3-(4-propoxyphenyl)prop-2-enenitrile (PubChem CID 134139010) has the molecular formula C20H21NO3
and a molecular weight of 323.39 g/mol. Its IUPAC name is (Z)-2-(3,5-dimethoxyphenyl)-3-(4-propoxyphenyl)prop-2-enenitrile.
Molecular Properties
| Compound Name | (Z)-2-(3,5-dimethoxyphenyl)-3-(4-propoxyphenyl)prop-2-enenitrile |
| PubChem CID | 134139010 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (Z)-2-(3,5-dimethoxyphenyl)-3-(4-propoxyphenyl)prop-2-enenitrile |
| SMILES | CCCOc1ccc(/C=C(\C#N)c2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C20H21NO3/c1-4-9-24-18-7-5-15(6-8-18)10-17(14-21)16-11-19(22-2)13-20(12-16)23-3/h5-8,10-13H,4,9H2,1-3H3/b17-10+ |
| InChIKey | PTZLJWRPYRSMIK-LICLKQGHSA-N |
| XLogP | 4.56 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(3,5-dimethoxyphenyl)-3-(4-propoxyphenyl)prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(3,5-dimethoxyphenyl)-3-(4-propoxyphenyl)prop-2-enenitrile?
The IUPAC name of (Z)-2-(3,5-dimethoxyphenyl)-3-(4-propoxyphenyl)prop-2-enenitrile (CID 134139010) is (Z)-2-(3,5-dimethoxyphenyl)-3-(4-propoxyphenyl)prop-2-enenitrile.
What is the SMILES notation for (Z)-2-(3,5-dimethoxyphenyl)-3-(4-propoxyphenyl)prop-2-enenitrile?
The canonical SMILES for (Z)-2-(3,5-dimethoxyphenyl)-3-(4-propoxyphenyl)prop-2-enenitrile is CCCOc1ccc(/C=C(\C#N)c2cc(OC)cc(OC)c2)cc1.
What is the InChIKey of (Z)-2-(3,5-dimethoxyphenyl)-3-(4-propoxyphenyl)prop-2-enenitrile?
The InChIKey is PTZLJWRPYRSMIK-LICLKQGHSA-N. The full InChI is InChI=1S/C20H21NO3/c1-4-9-24-18-7-5-15(6-8-18)10-17(14-21)16-11-19(22-2)13-20(12-16)23-3/h5-8,10-13H,4,9H2,1-3H3/b17-10+.
What are the key properties of (Z)-2-(3,5-dimethoxyphenyl)-3-(4-propoxyphenyl)prop-2-enenitrile?
(Z)-2-(3,5-dimethoxyphenyl)-3-(4-propoxyphenyl)prop-2-enenitrile has a molecular weight of 323.39 g/mol, XLogP of 4.56, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(3,5-dimethoxyphenyl)-3-(4-propoxyphenyl)prop-2-enenitrile is sourced from PubChem (CID 134139010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).