C22H21F2N5O9S — CID 134139049
2-[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonylcarbamoylamino]butanedioic acid (PubChem CID 134139049) has the molecular formula C22H21F2N5O9S and a molecular weight of 569.50 g/mol. Its IUPAC name is 2-[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonylcarbamoylamino]butanedioic acid.
| Compound Name | 2-[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonylcarbamoylamino]butanedioic acid |
|---|---|
| PubChem CID | 134139049 |
| Molecular Formula | C22H21F2N5O9S |
| Molecular Weight | 569.50 g/mol |
| Exact Mass | 569.10 |
| IUPAC Name | 2-[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonylcarbamoylamino]butanedioic acid |
| SMILES | C/C(=C\c1cc(F)c(Oc2ccc(S(=O)(=O)NC(=O)NC(CC(=O)O)C(=O)O)cc2)c(F)c1)C(=O)N=C(N)N |
| InChI | InChI=1S/C22H21F2N5O9S/c1-10(19(32)28-21(25)26)6-11-7-14(23)18(15(24)8-11)38-12-2-4-13(5-3-12)39(36,37)29-22(35)27-16(20(33)34)9-17(30)31/h2-8,16H,9H2,1H3,(H,30,31)(H,33,34)(H2,27,29,35)(H4,25,26,28,32)/b10-6+ |
| InChIKey | NGWLMMVAGBCVGQ-UXBLZVDNSA-N |
| XLogP | 0.88 |
| TPSA | 240.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.50 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|