C25H35NO3 — CID 134139086
(1R,4aS,10aR)-1,4a-dimethyl-6-[(E)-C-methyl-N-prop-2-enoxycarbonimidoyl]-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid (PubChem CID 134139086) has the molecular formula C25H35NO3 and a molecular weight of 397.56 g/mol. Its IUPAC name is (1R,4aS,10aR)-1,4a-dimethyl-6-[(E)-C-methyl-N-prop-2-enoxycarbonimidoyl]-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid.
| Compound Name | (1R,4aS,10aR)-1,4a-dimethyl-6-[(E)-C-methyl-N-prop-2-enoxycarbonimidoyl]-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 134139086 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | (1R,4aS,10aR)-1,4a-dimethyl-6-[(E)-C-methyl-N-prop-2-enoxycarbonimidoyl]-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
| SMILES | C=CCO/N=C(\C)c1cc2c(cc1C(C)C)CC[C@H]1[C@](C)(C(=O)O)CCC[C@]21C |
| InChI | InChI=1S/C25H35NO3/c1-7-13-29-26-17(4)20-15-21-18(14-19(20)16(2)3)9-10-22-24(21,5)11-8-12-25(22,6)23(27)28/h7,14-16,22H,1,8-13H2,2-6H3,(H,27,28)/b26-17+/t22-,24-,25-/m1/s1 |
| InChIKey | IDOXJXLAJMUKEP-VEHGLVSOSA-N |
| XLogP | 5.83 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|