About CID 134139339
CID 134139339 (PubChem CID 134139339) has the molecular formula C8H6BrO2Se
and a molecular weight of 293.00 g/mol.
Molecular Properties
| Compound Name | CID 134139339 |
| PubChem CID | 134139339 |
| Molecular Formula | C8H6BrO2Se |
| Molecular Weight | 293.00 g/mol |
| Exact Mass | 292.87 |
| IUPAC Name | — |
| SMILES | [Se]Cc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C8H6BrO2Se/c9-6-2-8-7(10-4-11-8)1-5(6)3-12/h1-2H,3-4H2 |
| InChIKey | TYGVOFBNBMJENH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.00 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 134139339 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134139339?
The IUPAC name of CID 134139339 (CID 134139339) is not available.
What is the SMILES notation for CID 134139339?
The canonical SMILES for CID 134139339 is [Se]Cc1cc2c(cc1Br)OCO2.
What is the InChIKey of CID 134139339?
The InChIKey is TYGVOFBNBMJENH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrO2Se/c9-6-2-8-7(10-4-11-8)1-5(6)3-12/h1-2H,3-4H2.
What are the key properties of CID 134139339?
CID 134139339 has a molecular weight of 293.00 g/mol, XLogP of 1.85, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134139339 is sourced from PubChem (CID 134139339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).