C18H21ClN6O — CID 134139389
4-amino-N-[2-(6-chloro-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)ethyl]-1H-imidazole-5-carboxamide (PubChem CID 134139389) has the molecular formula C18H21ClN6O and a molecular weight of 372.86 g/mol. Its IUPAC name is 4-amino-N-[2-(6-chloro-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)ethyl]-1H-imidazole-5-carboxamide.
| Compound Name | 4-amino-N-[2-(6-chloro-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)ethyl]-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 134139389 |
| Molecular Formula | C18H21ClN6O |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 4-amino-N-[2-(6-chloro-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)ethyl]-1H-imidazole-5-carboxamide |
| SMILES | CN1CCc2c(n(CCNC(=O)c3[nH]cnc3N)c3ccc(Cl)cc23)C1 |
| InChI | InChI=1S/C18H21ClN6O/c1-24-6-4-12-13-8-11(19)2-3-14(13)25(15(12)9-24)7-5-21-18(26)16-17(20)23-10-22-16/h2-3,8,10H,4-7,9,20H2,1H3,(H,21,26)(H,22,23) |
| InChIKey | AKKKJVXMRGHSEY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 91.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|