C14H17ClN2O3S — CID 134139675
(5S,6S,7S,7aR)-3-[(2-chlorophenyl)methylimino]-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole-6,7-diol (PubChem CID 134139675) has the molecular formula C14H17ClN2O3S and a molecular weight of 328.82 g/mol. Its IUPAC name is (5S,6S,7S,7aR)-3-[(2-chlorophenyl)methylimino]-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole-6,7-diol.
| Compound Name | (5S,6S,7S,7aR)-3-[(2-chlorophenyl)methylimino]-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 134139675 |
| Molecular Formula | C14H17ClN2O3S |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | (5S,6S,7S,7aR)-3-[(2-chlorophenyl)methylimino]-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole-6,7-diol |
| SMILES | OC[C@H]1[C@H](O)[C@@H](O)[C@@H]2CS/C(=N\Cc3ccccc3Cl)N12 |
| InChI | InChI=1S/C14H17ClN2O3S/c15-9-4-2-1-3-8(9)5-16-14-17-10(6-18)12(19)13(20)11(17)7-21-14/h1-4,10-13,18-20H,5-7H2/b16-14-/t10-,11-,12-,13-/m0/s1 |
| InChIKey | LVKUIKBFSRJPQD-WOIIQZHJSA-N |
| XLogP | 0.71 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|