C22H18F2N6O2 — CID 134140003
[2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-yl] (E)-3-phenylprop-2-enoate (PubChem CID 134140003) has the molecular formula C22H18F2N6O2 and a molecular weight of 436.42 g/mol. Its IUPAC name is [2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 134140003 |
| Molecular Formula | C22H18F2N6O2 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | [2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-yl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)OC(Cn1cncn1)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C22H18F2N6O2/c23-18-7-8-19(20(24)10-18)22(11-29-15-25-13-27-29,12-30-16-26-14-28-30)32-21(31)9-6-17-4-2-1-3-5-17/h1-10,13-16H,11-12H2/b9-6+ |
| InChIKey | RLLNUXUFCDMKKT-RMKNXTFCSA-N |
| XLogP | 3.00 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|