About 2-[5-(benzylamino)pentyl]-1,1-dioxo-1,2-benzothiazol-3-one
2-[5-(benzylamino)pentyl]-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 134140017) has the molecular formula C19H22N2O3S
and a molecular weight of 358.46 g/mol. Its IUPAC name is 2-[5-(benzylamino)pentyl]-1,1-dioxo-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 2-[5-(benzylamino)pentyl]-1,1-dioxo-1,2-benzothiazol-3-one |
| PubChem CID | 134140017 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-[5-(benzylamino)pentyl]-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | O=C1c2ccccc2S(=O)(=O)N1CCCCCNCc1ccccc1 |
| InChI | InChI=1S/C19H22N2O3S/c22-19-17-11-5-6-12-18(17)25(23,24)21(19)14-8-2-7-13-20-15-16-9-3-1-4-10-16/h1,3-6,9-12,20H,2,7-8,13-15H2 |
| InChIKey | ZGHYKEDJXGZSTQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(benzylamino)pentyl]-1,1-dioxo-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(benzylamino)pentyl]-1,1-dioxo-1,2-benzothiazol-3-one?
The IUPAC name of 2-[5-(benzylamino)pentyl]-1,1-dioxo-1,2-benzothiazol-3-one (CID 134140017) is 2-[5-(benzylamino)pentyl]-1,1-dioxo-1,2-benzothiazol-3-one.
What is the SMILES notation for 2-[5-(benzylamino)pentyl]-1,1-dioxo-1,2-benzothiazol-3-one?
The canonical SMILES for 2-[5-(benzylamino)pentyl]-1,1-dioxo-1,2-benzothiazol-3-one is O=C1c2ccccc2S(=O)(=O)N1CCCCCNCc1ccccc1.
What is the InChIKey of 2-[5-(benzylamino)pentyl]-1,1-dioxo-1,2-benzothiazol-3-one?
The InChIKey is ZGHYKEDJXGZSTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O3S/c22-19-17-11-5-6-12-18(17)25(23,24)21(19)14-8-2-7-13-20-15-16-9-3-1-4-10-16/h1,3-6,9-12,20H,2,7-8,13-15H2.
What are the key properties of 2-[5-(benzylamino)pentyl]-1,1-dioxo-1,2-benzothiazol-3-one?
2-[5-(benzylamino)pentyl]-1,1-dioxo-1,2-benzothiazol-3-one has a molecular weight of 358.46 g/mol, XLogP of 2.79, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(benzylamino)pentyl]-1,1-dioxo-1,2-benzothiazol-3-one is sourced from PubChem (CID 134140017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).