C31H35ClN6O4 — CID 134140064
1-[2-chloro-4-[[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]phenyl]-3-(3,4-dimethylphenyl)urea (PubChem CID 134140064) has the molecular formula C31H35ClN6O4 and a molecular weight of 591.11 g/mol. Its IUPAC name is 1-[2-chloro-4-[[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]phenyl]-3-(3,4-dimethylphenyl)urea.
| Compound Name | 1-[2-chloro-4-[[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]phenyl]-3-(3,4-dimethylphenyl)urea |
|---|---|
| PubChem CID | 134140064 |
| Molecular Formula | C31H35ClN6O4 |
| Molecular Weight | 591.11 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | 1-[2-chloro-4-[[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]amino]phenyl]-3-(3,4-dimethylphenyl)urea |
| SMILES | COc1cc2c(Nc3ccc(NC(=O)Nc4ccc(C)c(C)c4)c(Cl)c3)ncnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C31H35ClN6O4/c1-20-5-6-22(15-21(20)2)36-31(39)37-26-8-7-23(16-25(26)32)35-30-24-17-28(40-3)29(18-27(24)33-19-34-30)42-12-4-9-38-10-13-41-14-11-38/h5-8,15-19H,4,9-14H2,1-3H3,(H,33,34,35)(H2,36,37,39) |
| InChIKey | NQDPHKGACCXMEJ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 109.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.11 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|