C30H35Cl2NO3 — CID 134140131
(1R,4aS,10aR)-6-[C-(2,4-dichlorophenyl)-N-prop-2-enoxycarbonimidoyl]-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid (PubChem CID 134140131) has the molecular formula C30H35Cl2NO3 and a molecular weight of 528.52 g/mol. Its IUPAC name is (1R,4aS,10aR)-6-[C-(2,4-dichlorophenyl)-N-prop-2-enoxycarbonimidoyl]-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid.
| Compound Name | (1R,4aS,10aR)-6-[C-(2,4-dichlorophenyl)-N-prop-2-enoxycarbonimidoyl]-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 134140131 |
| Molecular Formula | C30H35Cl2NO3 |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | (1R,4aS,10aR)-6-[C-(2,4-dichlorophenyl)-N-prop-2-enoxycarbonimidoyl]-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
| SMILES | C=CCON=C(c1ccc(Cl)cc1Cl)c1cc2c(cc1C(C)C)CC[C@H]1[C@](C)(C(=O)O)CCC[C@]21C |
| InChI | InChI=1S/C30H35Cl2NO3/c1-6-14-36-33-27(21-10-9-20(31)16-25(21)32)23-17-24-19(15-22(23)18(2)3)8-11-26-29(24,4)12-7-13-30(26,5)28(34)35/h6,9-10,15-18,26H,1,7-8,11-14H2,2-5H3,(H,34,35)/t26-,29-,30-/m1/s1 |
| InChIKey | RQFQNAVAOSRSQN-KXTWMDTESA-N |
| XLogP | 8.17 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|