C19H24O4 — CID 134140387
(4S,4aS,7R,10aS)-7-ethenyl-4-hydroxy-1-(hydroxymethyl)-4a,7-dimethyl-4,5,6,8,10,10a-hexahydrophenanthrene-3,9-dione (PubChem CID 134140387) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is (4S,4aS,7R,10aS)-7-ethenyl-4-hydroxy-1-(hydroxymethyl)-4a,7-dimethyl-4,5,6,8,10,10a-hexahydrophenanthrene-3,9-dione.
| Compound Name | (4S,4aS,7R,10aS)-7-ethenyl-4-hydroxy-1-(hydroxymethyl)-4a,7-dimethyl-4,5,6,8,10,10a-hexahydrophenanthrene-3,9-dione |
|---|---|
| PubChem CID | 134140387 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (4S,4aS,7R,10aS)-7-ethenyl-4-hydroxy-1-(hydroxymethyl)-4a,7-dimethyl-4,5,6,8,10,10a-hexahydrophenanthrene-3,9-dione |
| SMILES | C=C[C@]1(C)CCC2=C(C1)C(=O)C[C@H]1C(CO)=CC(=O)[C@@H](O)[C@]21C |
| InChI | InChI=1S/C19H24O4/c1-4-18(2)6-5-13-12(9-18)15(21)8-14-11(10-20)7-16(22)17(23)19(13,14)3/h4,7,14,17,20,23H,1,5-6,8-10H2,2-3H3/t14-,17+,18+,19+/m0/s1 |
| InChIKey | NFZRXQHLYHVCAL-JEDBISTDSA-N |
| XLogP | 2.12 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|