C28H28Cl2N6O5 — CID 134140577
2-[3-(4-chlorophenyl)-4-[(4-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]-N-[(E)-[(E)-3-(5-methylfuran-2-yl)prop-2-enylidene]amino]acetamide (PubChem CID 134140577) has the molecular formula C28H28Cl2N6O5 and a molecular weight of 599.48 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-4-[(4-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]-N-[(E)-[(E)-3-(5-methylfuran-2-yl)prop-2-enylidene]amino]acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)-4-[(4-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]-N-[(E)-[(E)-3-(5-methylfuran-2-yl)prop-2-enylidene]amino]acetamide |
|---|---|
| PubChem CID | 134140577 |
| Molecular Formula | C28H28Cl2N6O5 |
| Molecular Weight | 599.48 g/mol |
| Exact Mass | 598.15 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-4-[(4-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]-N-[(E)-[(E)-3-(5-methylfuran-2-yl)prop-2-enylidene]amino]acetamide |
| SMILES | Cc1ccc(/C=C/C=N/NC(=O)CN2C(=O)N(c3ccc(Cl)cc3)C(N(O)C(=O)Nc3ccc(Cl)cc3)C2(C)C)o1 |
| InChI | InChI=1S/C28H28Cl2N6O5/c1-18-6-15-23(41-18)5-4-16-31-33-24(37)17-34-27(39)35(22-13-9-20(30)10-14-22)25(28(34,2)3)36(40)26(38)32-21-11-7-19(29)8-12-21/h4-16,25,40H,17H2,1-3H3,(H,32,38)(H,33,37)/b5-4+,31-16+ |
| InChIKey | OGKZIEPEKQVMTF-GKLDQLIVSA-N |
| XLogP | 5.98 |
| TPSA | 130.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.48 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|