C27H29NO5 — CID 134140599
(2E,6E)-2,6-bis[(4-methoxyphenyl)methylidene]-4-(morpholine-4-carbonyl)cyclohexan-1-one (PubChem CID 134140599) has the molecular formula C27H29NO5 and a molecular weight of 447.53 g/mol. Its IUPAC name is (2E,6E)-2,6-bis[(4-methoxyphenyl)methylidene]-4-(morpholine-4-carbonyl)cyclohexan-1-one.
| Compound Name | (2E,6E)-2,6-bis[(4-methoxyphenyl)methylidene]-4-(morpholine-4-carbonyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 134140599 |
| Molecular Formula | C27H29NO5 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (2E,6E)-2,6-bis[(4-methoxyphenyl)methylidene]-4-(morpholine-4-carbonyl)cyclohexan-1-one |
| SMILES | COc1ccc(/C=C2\CC(C(=O)N3CCOCC3)C/C(=C\c3ccc(OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H29NO5/c1-31-24-7-3-19(4-8-24)15-21-17-23(27(30)28-11-13-33-14-12-28)18-22(26(21)29)16-20-5-9-25(32-2)10-6-20/h3-10,15-16,23H,11-14,17-18H2,1-2H3/b21-15+,22-16+ |
| InChIKey | QSFLHZPPOYXXBN-YHARCJFQSA-N |
| XLogP | 4.01 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|