C33H29NO9 — CID 134140631
[(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 2-methylquinoline-6-carboxylate (PubChem CID 134140631) has the molecular formula C33H29NO9 and a molecular weight of 583.59 g/mol. Its IUPAC name is [(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 2-methylquinoline-6-carboxylate.
| Compound Name | [(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 2-methylquinoline-6-carboxylate |
|---|---|
| PubChem CID | 134140631 |
| Molecular Formula | C33H29NO9 |
| Molecular Weight | 583.59 g/mol |
| Exact Mass | 583.18 |
| IUPAC Name | [(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 2-methylquinoline-6-carboxylate |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@H](OC(=O)c3ccc5nc(C)ccc5c3)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C33H29NO9/c1-16-5-6-17-9-18(7-8-23(17)34-16)32(35)43-30-21-13-25-24(41-15-42-25)12-20(21)28(29-22(30)14-40-33(29)36)19-10-26(37-2)31(39-4)27(11-19)38-3/h5-13,22,28-30H,14-15H2,1-4H3/t22-,28+,29-,30-/m0/s1 |
| InChIKey | GKTRSPKVTKBRNF-SUAIOLNFSA-N |
| XLogP | 5.13 |
| TPSA | 111.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.59 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |