C19H18N2O3 — CID 134140792
N-(3,5-dimethyl-1,2-oxazol-4-yl)-3-methoxy-5-phenylbenzamide (PubChem CID 134140792) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is N-(3,5-dimethyl-1,2-oxazol-4-yl)-3-methoxy-5-phenylbenzamide.
| Compound Name | N-(3,5-dimethyl-1,2-oxazol-4-yl)-3-methoxy-5-phenylbenzamide |
|---|---|
| PubChem CID | 134140792 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-(3,5-dimethyl-1,2-oxazol-4-yl)-3-methoxy-5-phenylbenzamide |
| SMILES | COc1cc(C(=O)Nc2c(C)noc2C)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C19H18N2O3/c1-12-18(13(2)24-21-12)20-19(22)16-9-15(10-17(11-16)23-3)14-7-5-4-6-8-14/h4-11H,1-3H3,(H,20,22) |
| InChIKey | XKRINLNEHFBOFD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |