C12H17NO5 — CID 134140818
(3aR,4R,7S,7aR)-2-(2-hydroxyethyl)-3a-(hydroxymethyl)-7a-methyl-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 134140818) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is (3aR,4R,7S,7aR)-2-(2-hydroxyethyl)-3a-(hydroxymethyl)-7a-methyl-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4R,7S,7aR)-2-(2-hydroxyethyl)-3a-(hydroxymethyl)-7a-methyl-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 134140818 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | (3aR,4R,7S,7aR)-2-(2-hydroxyethyl)-3a-(hydroxymethyl)-7a-methyl-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | C[C@@]12C(=O)N(CCO)C(=O)[C@]1(CO)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C12H17NO5/c1-11-7-2-3-8(18-7)12(11,6-15)10(17)13(4-5-14)9(11)16/h7-8,14-15H,2-6H2,1H3/t7-,8+,11+,12-/m0/s1 |
| InChIKey | NDLFEGGUCLCOCE-MDSNHJATSA-N |
| XLogP | -1.11 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|