C23H20N6O2 — CID 134140871
2-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 134140871) has the molecular formula C23H20N6O2 and a molecular weight of 412.45 g/mol. Its IUPAC name is 2-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 134140871 |
| Molecular Formula | C23H20N6O2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | c1ccc(Nc2nc(Nc3ccccc3)nc(Nc3ccc4c(c3)OCCO4)n2)cc1 |
| InChI | InChI=1S/C23H20N6O2/c1-3-7-16(8-4-1)24-21-27-22(25-17-9-5-2-6-10-17)29-23(28-21)26-18-11-12-19-20(15-18)31-14-13-30-19/h1-12,15H,13-14H2,(H3,24,25,26,27,28,29) |
| InChIKey | QIZRWQRHMAFFBY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |