C20H24F2N10 — CID 134141444
1-N',4-N'-bis[N'-(3-fluorophenyl)carbamimidoyl]piperazine-1,4-dicarboximidamide (PubChem CID 134141444) has the molecular formula C20H24F2N10 and a molecular weight of 442.48 g/mol. Its IUPAC name is 1-N',4-N'-bis[N'-(3-fluorophenyl)carbamimidoyl]piperazine-1,4-dicarboximidamide.
| Compound Name | 1-N',4-N'-bis[N'-(3-fluorophenyl)carbamimidoyl]piperazine-1,4-dicarboximidamide |
|---|---|
| PubChem CID | 134141444 |
| Molecular Formula | C20H24F2N10 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 1-N',4-N'-bis[N'-(3-fluorophenyl)carbamimidoyl]piperazine-1,4-dicarboximidamide |
| SMILES | NC(=N\c1cccc(F)c1)/N=C(\N)N1CCN(/C(N)=N/C(N)=N/c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C20H24F2N10/c21-13-3-1-5-15(11-13)27-17(23)29-19(25)31-7-9-32(10-8-31)20(26)30-18(24)28-16-6-2-4-14(22)12-16/h1-6,11-12H,7-10H2,(H4,23,25,27,29)(H4,24,26,28,30) |
| InChIKey | UFDYZXHUXFXBJD-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 160.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|