C14H20N2O4 — CID 134141537
4-[(3aR,4S,7R,7aS)-7a-methyl-1,3-dioxo-4,5,6,7-tetrahydro-3aH-4,7-epoxyisoindol-2-yl]-N-methylbutanamide (PubChem CID 134141537) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 4-[(3aR,4S,7R,7aS)-7a-methyl-1,3-dioxo-4,5,6,7-tetrahydro-3aH-4,7-epoxyisoindol-2-yl]-N-methylbutanamide.
| Compound Name | 4-[(3aR,4S,7R,7aS)-7a-methyl-1,3-dioxo-4,5,6,7-tetrahydro-3aH-4,7-epoxyisoindol-2-yl]-N-methylbutanamide |
|---|---|
| PubChem CID | 134141537 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 4-[(3aR,4S,7R,7aS)-7a-methyl-1,3-dioxo-4,5,6,7-tetrahydro-3aH-4,7-epoxyisoindol-2-yl]-N-methylbutanamide |
| SMILES | CNC(=O)CCCN1C(=O)[C@H]2[C@@H]3CC[C@@H](O3)[C@@]2(C)C1=O |
| InChI | InChI=1S/C14H20N2O4/c1-14-9-6-5-8(20-9)11(14)12(18)16(13(14)19)7-3-4-10(17)15-2/h8-9,11H,3-7H2,1-2H3,(H,15,17)/t8-,9+,11+,14+/m0/s1 |
| InChIKey | LSVRQRSDTPBKME-AUDJIGTPSA-N |
| XLogP | 0.07 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|