C30H36N2O3 — CID 134141623
(8S,9S,11S,13S,14S,17S)-11,17-dihydroxy-13-methyl-17-(3-methylbut-1-ynyl)-N-(2-methyl-3-pyridinyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-carboxamide (PubChem CID 134141623) has the molecular formula C30H36N2O3 and a molecular weight of 472.63 g/mol. Its IUPAC name is (8S,9S,11S,13S,14S,17S)-11,17-dihydroxy-13-methyl-17-(3-methylbut-1-ynyl)-N-(2-methyl-3-pyridinyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-carboxamide.
| Compound Name | (8S,9S,11S,13S,14S,17S)-11,17-dihydroxy-13-methyl-17-(3-methylbut-1-ynyl)-N-(2-methyl-3-pyridinyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-carboxamide |
|---|---|
| PubChem CID | 134141623 |
| Molecular Formula | C30H36N2O3 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | (8S,9S,11S,13S,14S,17S)-11,17-dihydroxy-13-methyl-17-(3-methylbut-1-ynyl)-N-(2-methyl-3-pyridinyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-carboxamide |
| SMILES | Cc1ncccc1NC(=O)c1ccc2c(c1)CC[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1CC[C@@]2(O)C#CC(C)C |
| InChI | InChI=1S/C30H36N2O3/c1-18(2)11-13-30(35)14-12-24-23-10-7-20-16-21(28(34)32-25-6-5-15-31-19(25)3)8-9-22(20)27(23)26(33)17-29(24,30)4/h5-6,8-9,15-16,18,23-24,26-27,33,35H,7,10,12,14,17H2,1-4H3,(H,32,34)/t23-,24-,26-,27+,29-,30-/m0/s1 |
| InChIKey | AFNGPPDCJVQJQX-GYBXLDJFSA-N |
| XLogP | 4.86 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|