C14H10N2O — CID 134141779
14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,10,12-hexaen-8-one (PubChem CID 134141779) has the molecular formula C14H10N2O and a molecular weight of 222.25 g/mol. Its IUPAC name is 14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,10,12-hexaen-8-one.
| Compound Name | 14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,10,12-hexaen-8-one |
|---|---|
| PubChem CID | 134141779 |
| Molecular Formula | C14H10N2O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,10,12-hexaen-8-one |
| SMILES | O=C1c2ccccc2C2=C3C(=CC=CC13)NN2 |
| InChI | InChI=1S/C14H10N2O/c17-14-9-5-2-1-4-8(9)13-12-10(14)6-3-7-11(12)15-16-13/h1-7,10,15-16H |
| InChIKey | OKJVKBNMXBZHNY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |