C30H36O4 — CID 134141840
(1S,8R,10S)-8-benzoyl-9,9-dimethyl-6,10-bis(3-methylbut-2-enyl)-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione (PubChem CID 134141840) has the molecular formula C30H36O4 and a molecular weight of 460.61 g/mol. Its IUPAC name is (1S,8R,10S)-8-benzoyl-9,9-dimethyl-6,10-bis(3-methylbut-2-enyl)-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione.
| Compound Name | (1S,8R,10S)-8-benzoyl-9,9-dimethyl-6,10-bis(3-methylbut-2-enyl)-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione |
|---|---|
| PubChem CID | 134141840 |
| Molecular Formula | C30H36O4 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | (1S,8R,10S)-8-benzoyl-9,9-dimethyl-6,10-bis(3-methylbut-2-enyl)-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione |
| SMILES | CC(C)=CCC1=C2OCC[C@@]23C[C@H](CC=C(C)C)C(C)(C)[C@@](C(=O)c2ccccc2)(C1=O)C3=O |
| InChI | InChI=1S/C30H36O4/c1-19(2)12-14-22-18-29-16-17-34-26(29)23(15-13-20(3)4)25(32)30(27(29)33,28(22,5)6)24(31)21-10-8-7-9-11-21/h7-13,22H,14-18H2,1-6H3/t22-,29+,30-/m0/s1 |
| InChIKey | GIKIPJXUFBPECN-KBTGMKBMSA-N |
| XLogP | 6.43 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|