C24H22N2O — CID 134141847
2,4,5-trimethyl-6-(N-naphthalen-2-ylanilino)pyridin-3-ol (PubChem CID 134141847) has the molecular formula C24H22N2O and a molecular weight of 354.45 g/mol. Its IUPAC name is 2,4,5-trimethyl-6-(N-naphthalen-2-ylanilino)pyridin-3-ol.
| Compound Name | 2,4,5-trimethyl-6-(N-naphthalen-2-ylanilino)pyridin-3-ol |
|---|---|
| PubChem CID | 134141847 |
| Molecular Formula | C24H22N2O |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 2,4,5-trimethyl-6-(N-naphthalen-2-ylanilino)pyridin-3-ol |
| SMILES | Cc1nc(N(c2ccccc2)c2ccc3ccccc3c2)c(C)c(C)c1O |
| InChI | InChI=1S/C24H22N2O/c1-16-17(2)24(25-18(3)23(16)27)26(21-11-5-4-6-12-21)22-14-13-19-9-7-8-10-20(19)15-22/h4-15,27H,1-3H3 |
| InChIKey | MXWLMUQEZHUEDR-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |