C27H26N4O2 — CID 134141854
ethyl 13-anilino-3-benzyl-3,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene-4-carboxylate (PubChem CID 134141854) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is ethyl 13-anilino-3-benzyl-3,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene-4-carboxylate.
| Compound Name | ethyl 13-anilino-3-benzyl-3,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene-4-carboxylate |
|---|---|
| PubChem CID | 134141854 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | ethyl 13-anilino-3-benzyl-3,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene-4-carboxylate |
| SMILES | CCOC(=O)c1cc2c(n1Cc1ccccc1)-c1nc(Nc3ccccc3)ncc1CCC2 |
| InChI | InChI=1S/C27H26N4O2/c1-2-33-26(32)23-16-20-12-9-13-21-17-28-27(29-22-14-7-4-8-15-22)30-24(21)25(20)31(23)18-19-10-5-3-6-11-19/h3-8,10-11,14-17H,2,9,12-13,18H2,1H3,(H,28,29,30) |
| InChIKey | XGADVIZGQPXCJS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |