C33H34N2O3 — CID 134141987
(8S,9S,11S,13S,14S,17S)-11,17-dihydroxy-13-methyl-N-(2-methyl-3-pyridinyl)-17-(2-phenylethynyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-carboxamide (PubChem CID 134141987) has the molecular formula C33H34N2O3 and a molecular weight of 506.65 g/mol. Its IUPAC name is (8S,9S,11S,13S,14S,17S)-11,17-dihydroxy-13-methyl-N-(2-methyl-3-pyridinyl)-17-(2-phenylethynyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-carboxamide.
| Compound Name | (8S,9S,11S,13S,14S,17S)-11,17-dihydroxy-13-methyl-N-(2-methyl-3-pyridinyl)-17-(2-phenylethynyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-carboxamide |
|---|---|
| PubChem CID | 134141987 |
| Molecular Formula | C33H34N2O3 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | (8S,9S,11S,13S,14S,17S)-11,17-dihydroxy-13-methyl-N-(2-methyl-3-pyridinyl)-17-(2-phenylethynyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-carboxamide |
| SMILES | Cc1ncccc1NC(=O)c1ccc2c(c1)CC[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1CC[C@@]2(O)C#Cc1ccccc1 |
| InChI | InChI=1S/C33H34N2O3/c1-21-28(9-6-18-34-21)35-31(37)24-11-12-25-23(19-24)10-13-26-27-15-17-33(38,16-14-22-7-4-3-5-8-22)32(27,2)20-29(36)30(25)26/h3-9,11-12,18-19,26-27,29-30,36,38H,10,13,15,17,20H2,1-2H3,(H,35,37)/t26-,27-,29-,30+,32-,33-/m0/s1 |
| InChIKey | KOCQWYVXBLIRDI-KJOSVMAWSA-N |
| XLogP | 5.25 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|