C25H27NO3 — CID 134142037
(1E,4Z,6E)-5-(cyclohexylamino)-1,7-bis(4-hydroxyphenyl)hepta-1,4,6-trien-3-one (PubChem CID 134142037) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is (1E,4Z,6E)-5-(cyclohexylamino)-1,7-bis(4-hydroxyphenyl)hepta-1,4,6-trien-3-one.
| Compound Name | (1E,4Z,6E)-5-(cyclohexylamino)-1,7-bis(4-hydroxyphenyl)hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 134142037 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | (1E,4Z,6E)-5-(cyclohexylamino)-1,7-bis(4-hydroxyphenyl)hepta-1,4,6-trien-3-one |
| SMILES | O=C(/C=C(/C=C/c1ccc(O)cc1)NC1CCCCC1)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C25H27NO3/c27-23-13-7-19(8-14-23)6-12-22(26-21-4-2-1-3-5-21)18-25(29)17-11-20-9-15-24(28)16-10-20/h6-18,21,26-28H,1-5H2/b12-6+,17-11+,22-18- |
| InChIKey | RLVLBACOYPCJQE-QCDVCKLYSA-N |
| XLogP | 5.20 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|