About 2-[[4,4-difluoro-3-(2-phenylethyl)piperidin-1-yl]methyl]benzonitrile
2-[[4,4-difluoro-3-(2-phenylethyl)piperidin-1-yl]methyl]benzonitrile (PubChem CID 134142152) has the molecular formula C21H22F2N2
and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-[[4,4-difluoro-3-(2-phenylethyl)piperidin-1-yl]methyl]benzonitrile.
Molecular Properties
| Compound Name | 2-[[4,4-difluoro-3-(2-phenylethyl)piperidin-1-yl]methyl]benzonitrile |
| PubChem CID | 134142152 |
| Molecular Formula | C21H22F2N2 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 2-[[4,4-difluoro-3-(2-phenylethyl)piperidin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1CN1CCC(F)(F)C(CCc2ccccc2)C1 |
| InChI | InChI=1S/C21H22F2N2/c22-21(23)12-13-25(15-19-9-5-4-8-18(19)14-24)16-20(21)11-10-17-6-2-1-3-7-17/h1-9,20H,10-13,15-16H2 |
| InChIKey | QQSFZDUKBGDGFJ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[[4,4-difluoro-3-(2-phenylethyl)piperidin-1-yl]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4,4-difluoro-3-(2-phenylethyl)piperidin-1-yl]methyl]benzonitrile?
The IUPAC name of 2-[[4,4-difluoro-3-(2-phenylethyl)piperidin-1-yl]methyl]benzonitrile (CID 134142152) is 2-[[4,4-difluoro-3-(2-phenylethyl)piperidin-1-yl]methyl]benzonitrile.
What is the SMILES notation for 2-[[4,4-difluoro-3-(2-phenylethyl)piperidin-1-yl]methyl]benzonitrile?
The canonical SMILES for 2-[[4,4-difluoro-3-(2-phenylethyl)piperidin-1-yl]methyl]benzonitrile is N#Cc1ccccc1CN1CCC(F)(F)C(CCc2ccccc2)C1.
What is the InChIKey of 2-[[4,4-difluoro-3-(2-phenylethyl)piperidin-1-yl]methyl]benzonitrile?
The InChIKey is QQSFZDUKBGDGFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22F2N2/c22-21(23)12-13-25(15-19-9-5-4-8-18(19)14-24)16-20(21)11-10-17-6-2-1-3-7-17/h1-9,20H,10-13,15-16H2.
What are the key properties of 2-[[4,4-difluoro-3-(2-phenylethyl)piperidin-1-yl]methyl]benzonitrile?
2-[[4,4-difluoro-3-(2-phenylethyl)piperidin-1-yl]methyl]benzonitrile has a molecular weight of 340.42 g/mol, XLogP of 4.65, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4,4-difluoro-3-(2-phenylethyl)piperidin-1-yl]methyl]benzonitrile is sourced from PubChem (CID 134142152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).