C10H12ClN3S — CID 134142300
4-(4-chlorophenyl)-5,5-dimethyl-1,2,4-triazolidine-3-thione (PubChem CID 134142300) has the molecular formula C10H12ClN3S and a molecular weight of 241.75 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-5,5-dimethyl-1,2,4-triazolidine-3-thione.
| Compound Name | 4-(4-chlorophenyl)-5,5-dimethyl-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 134142300 |
| Molecular Formula | C10H12ClN3S |
| Molecular Weight | 241.75 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 4-(4-chlorophenyl)-5,5-dimethyl-1,2,4-triazolidine-3-thione |
| SMILES | CC1(C)NNC(=S)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H12ClN3S/c1-10(2)13-12-9(15)14(10)8-5-3-7(11)4-6-8/h3-6,13H,1-2H3,(H,12,15) |
| InChIKey | CIUIOEBKZXWYHQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.75 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|