C21H29NO3S — CID 134142390
(3aS,6R,6aS,9aR,9bR)-6-ethyl-1-(4-methylphenyl)sulfonyl-3,3a,4,6,6a,7,8,9,9a,9b-decahydro-2H-benzo[de]quinolin-5-one (PubChem CID 134142390) has the molecular formula C21H29NO3S and a molecular weight of 375.53 g/mol. Its IUPAC name is (3aS,6R,6aS,9aR,9bR)-6-ethyl-1-(4-methylphenyl)sulfonyl-3,3a,4,6,6a,7,8,9,9a,9b-decahydro-2H-benzo[de]quinolin-5-one.
| Compound Name | (3aS,6R,6aS,9aR,9bR)-6-ethyl-1-(4-methylphenyl)sulfonyl-3,3a,4,6,6a,7,8,9,9a,9b-decahydro-2H-benzo[de]quinolin-5-one |
|---|---|
| PubChem CID | 134142390 |
| Molecular Formula | C21H29NO3S |
| Molecular Weight | 375.53 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | (3aS,6R,6aS,9aR,9bR)-6-ethyl-1-(4-methylphenyl)sulfonyl-3,3a,4,6,6a,7,8,9,9a,9b-decahydro-2H-benzo[de]quinolin-5-one |
| SMILES | CC[C@H]1C(=O)C[C@@H]2CCN(S(=O)(=O)c3ccc(C)cc3)[C@@H]3CCC[C@H]1[C@@H]23 |
| InChI | InChI=1S/C21H29NO3S/c1-3-17-18-5-4-6-19-21(18)15(13-20(17)23)11-12-22(19)26(24,25)16-9-7-14(2)8-10-16/h7-10,15,17-19,21H,3-6,11-13H2,1-2H3/t15-,17+,18+,19+,21+/m0/s1 |
| InChIKey | PZMUSBZBIIMWES-PPVISPMTSA-N |
| XLogP | 3.79 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |