C30H24F6O4 — CID 134142452
(1E,4E)-1-[2,5-bis(trifluoromethyl)phenyl]-5-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]penta-1,4-dien-3-one (PubChem CID 134142452) has the molecular formula C30H24F6O4 and a molecular weight of 562.51 g/mol. Its IUPAC name is (1E,4E)-1-[2,5-bis(trifluoromethyl)phenyl]-5-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-[2,5-bis(trifluoromethyl)phenyl]-5-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 134142452 |
| Molecular Formula | C30H24F6O4 |
| Molecular Weight | 562.51 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | (1E,4E)-1-[2,5-bis(trifluoromethyl)phenyl]-5-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]penta-1,4-dien-3-one |
| SMILES | COc1ccc(/C=C/c2cc(OC)cc(OC)c2/C=C/C(=O)/C=C/c2cc(C(F)(F)F)ccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H24F6O4/c1-38-24-12-5-19(6-13-24)4-7-20-17-25(39-2)18-28(40-3)26(20)14-11-23(37)10-8-21-16-22(29(31,32)33)9-15-27(21)30(34,35)36/h4-18H,1-3H3/b7-4+,10-8+,14-11+ |
| InChIKey | IWQYSSFVHPCIOF-IIXWSKKDSA-N |
| XLogP | 8.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.51 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|