C24H25F3N4OS — CID 134142518
(3R,5S)-N-benzyl-3,5-dimethyl-1-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxamide (PubChem CID 134142518) has the molecular formula C24H25F3N4OS and a molecular weight of 474.55 g/mol. Its IUPAC name is (3R,5S)-N-benzyl-3,5-dimethyl-1-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxamide.
| Compound Name | (3R,5S)-N-benzyl-3,5-dimethyl-1-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxamide |
|---|---|
| PubChem CID | 134142518 |
| Molecular Formula | C24H25F3N4OS |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | (3R,5S)-N-benzyl-3,5-dimethyl-1-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxamide |
| SMILES | C[C@@H]1CN(Cc2cnc(C(F)(F)F)s2)c2ccccc2[C@H](C)N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H25F3N4OS/c1-16-14-30(15-19-13-28-22(33-19)24(25,26)27)21-11-7-6-10-20(21)17(2)31(16)23(32)29-12-18-8-4-3-5-9-18/h3-11,13,16-17H,12,14-15H2,1-2H3,(H,29,32)/t16-,17+/m1/s1 |
| InChIKey | YPEYQKOBQFSLNA-SJORKVTESA-N |
| XLogP | 5.84 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |