C20H27FO5 — CID 134142593
(4aR,8R,8aR)-4-fluoro-4,7-dimethyl-2-(3,4,5-trimethoxyphenyl)-2,3,4a,5,8,8a-hexahydrochromen-8-ol (PubChem CID 134142593) has the molecular formula C20H27FO5 and a molecular weight of 366.43 g/mol. Its IUPAC name is (4aR,8R,8aR)-4-fluoro-4,7-dimethyl-2-(3,4,5-trimethoxyphenyl)-2,3,4a,5,8,8a-hexahydrochromen-8-ol.
| Compound Name | (4aR,8R,8aR)-4-fluoro-4,7-dimethyl-2-(3,4,5-trimethoxyphenyl)-2,3,4a,5,8,8a-hexahydrochromen-8-ol |
|---|---|
| PubChem CID | 134142593 |
| Molecular Formula | C20H27FO5 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | (4aR,8R,8aR)-4-fluoro-4,7-dimethyl-2-(3,4,5-trimethoxyphenyl)-2,3,4a,5,8,8a-hexahydrochromen-8-ol |
| SMILES | COc1cc(C2CC(C)(F)[C@@H]3CC=C(C)[C@@H](O)[C@@H]3O2)cc(OC)c1OC |
| InChI | InChI=1S/C20H27FO5/c1-11-6-7-13-18(17(11)22)26-16(10-20(13,2)21)12-8-14(23-3)19(25-5)15(9-12)24-4/h6,8-9,13,16-18,22H,7,10H2,1-5H3/t13-,16?,17-,18-,20?/m1/s1 |
| InChIKey | VHBNMPDAZYGSTM-PKVRVGIMSA-N |
| XLogP | 3.60 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|