C27H48N4O5S — CID 134142802
(2S)-2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]sulfamoylamino]-3-piperidin-4-ylpropanoic acid (PubChem CID 134142802) has the molecular formula C27H48N4O5S and a molecular weight of 540.77 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]sulfamoylamino]-3-piperidin-4-ylpropanoic acid.
| Compound Name | (2S)-2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]sulfamoylamino]-3-piperidin-4-ylpropanoic acid |
|---|---|
| PubChem CID | 134142802 |
| Molecular Formula | C27H48N4O5S |
| Molecular Weight | 540.77 g/mol |
| Exact Mass | 540.33 |
| IUPAC Name | (2S)-2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]sulfamoylamino]-3-piperidin-4-ylpropanoic acid |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](NC(=O)[C@H](CC1CCCCC1)NS(=O)(=O)N[C@@H](CC1CCNCC1)C(=O)O)C2 |
| InChI | InChI=1S/C27H48N4O5S/c1-26(2)20-9-12-27(26,3)23(17-20)29-24(32)21(15-18-7-5-4-6-8-18)30-37(35,36)31-22(25(33)34)16-19-10-13-28-14-11-19/h18-23,28,30-31H,4-17H2,1-3H3,(H,29,32)(H,33,34)/t20-,21+,22+,23+,27+/m1/s1 |
| InChIKey | LTLYKPLPFHCOED-BXOWXZKISA-N |
| XLogP | 2.92 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.77 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |