C17H24N2 — CID 134142903
7-(cyclobutylmethyl)-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoline (PubChem CID 134142903) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 7-(cyclobutylmethyl)-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoline.
| Compound Name | 7-(cyclobutylmethyl)-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoline |
|---|---|
| PubChem CID | 134142903 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 7-(cyclobutylmethyl)-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoline |
| SMILES | c1cc(CC2CCC2)c2c(c1)N1CCNCC1CC2 |
| InChI | InChI=1S/C17H24N2/c1-3-13(4-1)11-14-5-2-6-17-16(14)8-7-15-12-18-9-10-19(15)17/h2,5-6,13,15,18H,1,3-4,7-12H2 |
| InChIKey | LABWPGUAXBMYED-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |