C20H18ClF2N5O2S — CID 134143059
5-chloro-2-N-[(E)-(2,4-difluorophenyl)methylideneamino]-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine (PubChem CID 134143059) has the molecular formula C20H18ClF2N5O2S and a molecular weight of 465.91 g/mol. Its IUPAC name is 5-chloro-2-N-[(E)-(2,4-difluorophenyl)methylideneamino]-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-[(E)-(2,4-difluorophenyl)methylideneamino]-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 134143059 |
| Molecular Formula | C20H18ClF2N5O2S |
| Molecular Weight | 465.91 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 5-chloro-2-N-[(E)-(2,4-difluorophenyl)methylideneamino]-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine |
| SMILES | CC(C)S(=O)(=O)c1ccccc1Nc1nc(N/N=C/c2ccc(F)cc2F)ncc1Cl |
| InChI | InChI=1S/C20H18ClF2N5O2S/c1-12(2)31(29,30)18-6-4-3-5-17(18)26-19-15(21)11-24-20(27-19)28-25-10-13-7-8-14(22)9-16(13)23/h3-12H,1-2H3,(H2,24,26,27,28)/b25-10+ |
| InChIKey | PVHGQNMQICBDLS-KIBLKLHPSA-N |
| XLogP | 4.78 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.91 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|