C22H20N2O — CID 134143089
(6S,6aR,11bR)-6-(3-methoxyphenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c][1,5]naphthyridine (PubChem CID 134143089) has the molecular formula C22H20N2O and a molecular weight of 328.42 g/mol. Its IUPAC name is (6S,6aR,11bR)-6-(3-methoxyphenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c][1,5]naphthyridine.
| Compound Name | (6S,6aR,11bR)-6-(3-methoxyphenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c][1,5]naphthyridine |
|---|---|
| PubChem CID | 134143089 |
| Molecular Formula | C22H20N2O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (6S,6aR,11bR)-6-(3-methoxyphenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c][1,5]naphthyridine |
| SMILES | COc1cccc([C@H]2Nc3cccnc3[C@H]3c4ccccc4C[C@H]32)c1 |
| InChI | InChI=1S/C22H20N2O/c1-25-16-8-4-7-15(12-16)21-18-13-14-6-2-3-9-17(14)20(18)22-19(24-21)10-5-11-23-22/h2-12,18,20-21,24H,13H2,1H3/t18-,20+,21-/m1/s1 |
| InChIKey | IWOOEXGFQSDCJH-HLAWJBBLSA-N |
| XLogP | 4.56 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |